C21H34S2 — CID 134878684
(1'S,4'R,9'R,10'R,13'R)-5',5',9'-trimethylspiro[1,3-dithiolane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane] (PubChem CID 134878684) has the molecular formula C21H34S2 and a molecular weight of 350.64 g/mol. Its IUPAC name is (1'S,4'R,9'R,10'R,13'R)-5',5',9'-trimethylspiro[1,3-dithiolane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane].
| Compound Name | (1'S,4'R,9'R,10'R,13'R)-5',5',9'-trimethylspiro[1,3-dithiolane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane] |
|---|---|
| PubChem CID | 134878684 |
| Molecular Formula | C21H34S2 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1'S,4'R,9'R,10'R,13'R)-5',5',9'-trimethylspiro[1,3-dithiolane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane] |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CC[C@@]13C[C@@H](CC[C@H]12)C1(C3)SCCS1 |
| InChI | InChI=1S/C21H34S2/c1-18(2)8-4-9-19(3)16(18)7-10-20-13-15(5-6-17(19)20)21(14-20)22-11-12-23-21/h15-17H,4-14H2,1-3H3/t15-,16-,17+,19-,20+/m1/s1 |
| InChIKey | KBSGRWCGSHYOST-VROUVPMXSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |