C21H36S2 — CID 10316029
2-[(2S,4aS,4bR,10aS)-4b,8,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthren-2-yl]-2-methyl-1,3-dithiolane (PubChem CID 10316029) has the molecular formula C21H36S2 and a molecular weight of 352.65 g/mol. Its IUPAC name is 2-[(2S,4aS,4bR,10aS)-4b,8,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthren-2-yl]-2-methyl-1,3-dithiolane.
| Compound Name | 2-[(2S,4aS,4bR,10aS)-4b,8,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthren-2-yl]-2-methyl-1,3-dithiolane |
|---|---|
| PubChem CID | 10316029 |
| Molecular Formula | C21H36S2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-[(2S,4aS,4bR,10aS)-4b,8,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthren-2-yl]-2-methyl-1,3-dithiolane |
| SMILES | CC1(C)CCC[C@@]2(C)C1CC[C@H]1C[C@@H](C3(C)SCCS3)CC[C@@H]12 |
| InChI | InChI=1S/C21H36S2/c1-19(2)10-5-11-20(3)17-8-7-16(21(4)22-12-13-23-21)14-15(17)6-9-18(19)20/h15-18H,5-14H2,1-4H3/t15-,16-,17-,18?,20+/m0/s1 |
| InChIKey | GBNOBTOTUCZNQY-ABZWTPRMSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |