C17H30S2 — CID 554408
1,8a-dimethyl-8-propan-2-ylspiro[1,2,3,4,4a,6,7,8-octahydronaphthalene-5,2'-1,3-dithiolane] (PubChem CID 554408) has the molecular formula C17H30S2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 1,8a-dimethyl-8-propan-2-ylspiro[1,2,3,4,4a,6,7,8-octahydronaphthalene-5,2'-1,3-dithiolane].
| Compound Name | 1,8a-dimethyl-8-propan-2-ylspiro[1,2,3,4,4a,6,7,8-octahydronaphthalene-5,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 554408 |
| Molecular Formula | C17H30S2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1,8a-dimethyl-8-propan-2-ylspiro[1,2,3,4,4a,6,7,8-octahydronaphthalene-5,2'-1,3-dithiolane] |
| SMILES | CC(C)C1CCC2(SCCS2)C2CCCC(C)C12C |
| InChI | InChI=1S/C17H30S2/c1-12(2)14-8-9-17(18-10-11-19-17)15-7-5-6-13(3)16(14,15)4/h12-15H,5-11H2,1-4H3 |
| InChIKey | CSVULRDGZOKZGB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |