C20H36S — CID 102115722
(4aS,5'S,7S,8R,8aS)-5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-thiolane] (PubChem CID 102115722) has the molecular formula C20H36S and a molecular weight of 308.57 g/mol. Its IUPAC name is (4aS,5'S,7S,8R,8aS)-5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-thiolane].
| Compound Name | (4aS,5'S,7S,8R,8aS)-5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-thiolane] |
|---|---|
| PubChem CID | 102115722 |
| Molecular Formula | C20H36S |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (4aS,5'S,7S,8R,8aS)-5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-thiolane] |
| SMILES | CC[C@@]1(C)CC[C@@]2(S1)[C@@H](C)CC[C@H]1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C20H36S/c1-7-18(5)13-14-20(21-18)15(2)9-10-16-17(3,4)11-8-12-19(16,20)6/h15-16H,7-14H2,1-6H3/t15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | JBECVDNRDJJXSA-CZKCSJLSSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |