C34H48LiN3O6 — CID 134879073
lithium [(3S)-3-(dibenzylamino)-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134879073) has the molecular formula C34H48LiN3O6 and a molecular weight of 601.71 g/mol. Its IUPAC name is lithium [(3S)-3-(dibenzylamino)-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | lithium [(3S)-3-(dibenzylamino)-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134879073 |
| Molecular Formula | C34H48LiN3O6 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | lithium [(3S)-3-(dibenzylamino)-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)CN(C(=O)O[CH-][C@H](CCOC(=O)N2CC(C)(C)OC2(C)C)N(Cc2ccccc2)Cc2ccccc2)C(C)(C)O1.[Li+] |
| InChI | InChI=1S/C34H48N3O6.Li/c1-31(2)24-36(33(5,6)42-31)29(38)40-20-19-28(23-41-30(39)37-25-32(3,4)43-34(37,7)8)35(21-26-15-11-9-12-16-26)22-27-17-13-10-14-18-27;/h9-18,23,28H,19-22,24-25H2,1-8H3;/q-1;+1/t28-;/m0./s1 |
| InChIKey | BETGZBKEUHEKFB-JCOPYZAKSA-N |
| XLogP | 3.58 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|