C40H53N3O6S — CID 134937967
[(3S,4S)-3-(dibenzylamino)-4-phenylsulfanyl-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134937967) has the molecular formula C40H53N3O6S and a molecular weight of 703.95 g/mol. Its IUPAC name is [(3S,4S)-3-(dibenzylamino)-4-phenylsulfanyl-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(3S,4S)-3-(dibenzylamino)-4-phenylsulfanyl-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134937967 |
| Molecular Formula | C40H53N3O6S |
| Molecular Weight | 703.95 g/mol |
| Exact Mass | 703.37 |
| IUPAC Name | [(3S,4S)-3-(dibenzylamino)-4-phenylsulfanyl-4-(2,2,5,5-tetramethyl-1,3-oxazolidine-3-carbonyl)oxybutyl] 2,2,5,5-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)CN(C(=O)OCC[C@@H]([C@@H](OC(=O)N2CC(C)(C)OC2(C)C)Sc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C40H53N3O6S/c1-37(2)28-42(39(5,6)48-37)35(44)46-25-24-33(41(26-30-18-12-9-13-19-30)27-31-20-14-10-15-21-31)34(50-32-22-16-11-17-23-32)47-36(45)43-29-38(3,4)49-40(43,7)8/h9-23,33-34H,24-29H2,1-8H3/t33-,34-/m0/s1 |
| InChIKey | CPZYUFICHRBQLI-HEVIKAOCSA-N |
| XLogP | 8.53 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.95 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|