C18H20O3S — CID 134879202
(E)-6-(benzenesulfonyl)-1-phenylhex-5-en-3-ol (PubChem CID 134879202) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is (E)-6-(benzenesulfonyl)-1-phenylhex-5-en-3-ol.
| Compound Name | (E)-6-(benzenesulfonyl)-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 134879202 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (E)-6-(benzenesulfonyl)-1-phenylhex-5-en-3-ol |
| SMILES | O=S(=O)(/C=C/CC(O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O3S/c19-17(14-13-16-8-3-1-4-9-16)10-7-15-22(20,21)18-11-5-2-6-12-18/h1-9,11-12,15,17,19H,10,13-14H2/b15-7+ |
| InChIKey | SKWMKTFIXWBOOG-VIZOYTHASA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |