C32H67IO4Si3 — CID 134879298
[(2R,3R,4R)-6-iodo-2,3-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134879298) has the molecular formula C32H67IO4Si3 and a molecular weight of 727.05 g/mol. Its IUPAC name is [(2R,3R,4R)-6-iodo-2,3-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R,4R)-6-iodo-2,3-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134879298 |
| Molecular Formula | C32H67IO4Si3 |
| Molecular Weight | 727.05 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | [(2R,3R,4R)-6-iodo-2,3-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@H]1OC(I)=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H67IO4Si3/c1-20(2)38(21(3)4,22(5)6)35-29-19-30(33)34-32(37-40(26(13)14,27(15)16)28(17)18)31(29)36-39(23(7)8,24(9)10)25(11)12/h19-29,31-32H,1-18H3/t29-,31-,32-/m1/s1 |
| InChIKey | WWNMQRSSOBOZLV-AFEGNUHBSA-N |
| XLogP | 11.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.05 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|