C26H29N3S — CID 134879436
1-[1-(4-methylphenyl)-2-(4-methylphenyl)sulfanylhexan-2-yl]benzotriazole (PubChem CID 134879436) has the molecular formula C26H29N3S and a molecular weight of 415.61 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)-2-(4-methylphenyl)sulfanylhexan-2-yl]benzotriazole.
| Compound Name | 1-[1-(4-methylphenyl)-2-(4-methylphenyl)sulfanylhexan-2-yl]benzotriazole |
|---|---|
| PubChem CID | 134879436 |
| Molecular Formula | C26H29N3S |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[1-(4-methylphenyl)-2-(4-methylphenyl)sulfanylhexan-2-yl]benzotriazole |
| SMILES | CCCCC(Cc1ccc(C)cc1)(Sc1ccc(C)cc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C26H29N3S/c1-4-5-18-26(19-22-14-10-20(2)11-15-22,30-23-16-12-21(3)13-17-23)29-25-9-7-6-8-24(25)27-28-29/h6-17H,4-5,18-19H2,1-3H3 |
| InChIKey | MKILZKZXLCVRHW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |