About 2-isocyanato-2,3-diphenyloxirane
2-isocyanato-2,3-diphenyloxirane (PubChem CID 134879698) has the molecular formula C15H11NO2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-isocyanato-2,3-diphenyloxirane.
Molecular Properties
| Compound Name | 2-isocyanato-2,3-diphenyloxirane |
| PubChem CID | 134879698 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-isocyanato-2,3-diphenyloxirane |
| SMILES | O=C=NC1(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C15H11NO2/c17-11-16-15(13-9-5-2-6-10-13)14(18-15)12-7-3-1-4-8-12/h1-10,14H |
| InChIKey | IYCNMPOWIGBAQL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-2,3-diphenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-2,3-diphenyloxirane?
The IUPAC name of 2-isocyanato-2,3-diphenyloxirane (CID 134879698) is 2-isocyanato-2,3-diphenyloxirane.
What is the SMILES notation for 2-isocyanato-2,3-diphenyloxirane?
The canonical SMILES for 2-isocyanato-2,3-diphenyloxirane is O=C=NC1(c2ccccc2)OC1c1ccccc1.
What is the InChIKey of 2-isocyanato-2,3-diphenyloxirane?
The InChIKey is IYCNMPOWIGBAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c17-11-16-15(13-9-5-2-6-10-13)14(18-15)12-7-3-1-4-8-12/h1-10,14H.
What are the key properties of 2-isocyanato-2,3-diphenyloxirane?
2-isocyanato-2,3-diphenyloxirane has a molecular weight of 237.26 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-2,3-diphenyloxirane is sourced from PubChem (CID 134879698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).