C22H21F3O4S — CID 134879946
[2-[2-(ethoxymethyl)naphthalen-1-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 134879946) has the molecular formula C22H21F3O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is [2-[2-(ethoxymethyl)naphthalen-1-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-(ethoxymethyl)naphthalen-1-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134879946 |
| Molecular Formula | C22H21F3O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [2-[2-(ethoxymethyl)naphthalen-1-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | CCOCc1ccc2ccccc2c1-c1c(C)cc(C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H21F3O4S/c1-4-28-13-17-10-9-16-7-5-6-8-18(16)21(17)20-15(3)11-14(2)12-19(20)29-30(26,27)22(23,24)25/h5-12H,4,13H2,1-3H3 |
| InChIKey | UDKWLDPIOAUTNB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|