About lithium diethyl(phenyl)phosphane
lithium diethyl(phenyl)phosphane (PubChem CID 134880031) has the molecular formula C10H14LiP
and a molecular weight of 172.14 g/mol. Its IUPAC name is lithium diethyl(phenyl)phosphane.
Molecular Properties
| Compound Name | lithium diethyl(phenyl)phosphane |
| PubChem CID | 134880031 |
| Molecular Formula | C10H14LiP |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | lithium diethyl(phenyl)phosphane |
| SMILES | CCP(CC)c1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C10H14P.Li/c1-3-11(4-2)10-8-6-5-7-9-10;/h5-8H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | PWLLZWCKUYBHIP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium diethyl(phenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium diethyl(phenyl)phosphane?
The IUPAC name of lithium diethyl(phenyl)phosphane (CID 134880031) is lithium diethyl(phenyl)phosphane.
What is the SMILES notation for lithium diethyl(phenyl)phosphane?
The canonical SMILES for lithium diethyl(phenyl)phosphane is CCP(CC)c1[c-]cccc1.[Li+].
What is the InChIKey of lithium diethyl(phenyl)phosphane?
The InChIKey is PWLLZWCKUYBHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14P.Li/c1-3-11(4-2)10-8-6-5-7-9-10;/h5-8H,3-4H2,1-2H3;/q-1;+1.
What are the key properties of lithium diethyl(phenyl)phosphane?
lithium diethyl(phenyl)phosphane has a molecular weight of 172.14 g/mol, XLogP of -0.36, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium diethyl(phenyl)phosphane is sourced from PubChem (CID 134880031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).