C26H50OSn — CID 134880474
tributyl-[(2-methyl-5-prop-1-en-2-ylnona-1,8-dien-3-yl)oxymethyl]stannane (PubChem CID 134880474) has the molecular formula C26H50OSn and a molecular weight of 497.40 g/mol. Its IUPAC name is tributyl-[(2-methyl-5-prop-1-en-2-ylnona-1,8-dien-3-yl)oxymethyl]stannane.
| Compound Name | tributyl-[(2-methyl-5-prop-1-en-2-ylnona-1,8-dien-3-yl)oxymethyl]stannane |
|---|---|
| PubChem CID | 134880474 |
| Molecular Formula | C26H50OSn |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | tributyl-[(2-methyl-5-prop-1-en-2-ylnona-1,8-dien-3-yl)oxymethyl]stannane |
| SMILES | C=CCCC(CC(OC[Sn](CCCC)(CCCC)CCCC)C(=C)C)C(=C)C |
| InChI | InChI=1S/C14H23O.3C4H9.Sn/c1-7-8-9-13(11(2)3)10-14(15-6)12(4)5;3*1-3-4-2;/h7,13-14H,1-2,4,6,8-10H2,3,5H3;3*1,3-4H2,2H3; |
| InChIKey | DQAJTIQRARYFNT-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|