C12H22O3 — CID 134880617
propan-2-yl 2-[(E,3R)-2-methylhex-4-en-3-yl]oxyacetate (PubChem CID 134880617) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is propan-2-yl 2-[(E,3R)-2-methylhex-4-en-3-yl]oxyacetate.
| Compound Name | propan-2-yl 2-[(E,3R)-2-methylhex-4-en-3-yl]oxyacetate |
|---|---|
| PubChem CID | 134880617 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | propan-2-yl 2-[(E,3R)-2-methylhex-4-en-3-yl]oxyacetate |
| SMILES | C/C=C/[C@H](OCC(=O)OC(C)C)C(C)C |
| InChI | InChI=1S/C12H22O3/c1-6-7-11(9(2)3)14-8-12(13)15-10(4)5/h6-7,9-11H,8H2,1-5H3/b7-6+/t11-/m0/s1 |
| InChIKey | MCOKXHJSFZALMK-MLRMMBSGSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|