C29H33NO5S — CID 134881751
(4R)-3-[1-(benzenesulfonyl)-5-phenylmethoxypentyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 134881751) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is (4R)-3-[1-(benzenesulfonyl)-5-phenylmethoxypentyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[1-(benzenesulfonyl)-5-phenylmethoxypentyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134881751 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (4R)-3-[1-(benzenesulfonyl)-5-phenylmethoxypentyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(CCCCOCc2ccccc2)S(=O)(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H33NO5S/c1-29(2)27(24-16-8-4-9-17-24)30(28(31)35-29)26(36(32,33)25-18-10-5-11-19-25)20-12-13-21-34-22-23-14-6-3-7-15-23/h3-11,14-19,26-27H,12-13,20-22H2,1-2H3/t26?,27-/m1/s1 |
| InChIKey | SDJSRVMBSKQWLP-SSYAZFEXSA-N |
| XLogP | 6.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|