C29H34N2O4S — CID 10720374
(4S,5R)-1-[(1S)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-3,4-dimethyl-5-phenylimidazolidin-2-one (PubChem CID 10720374) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is (4S,5R)-1-[(1S)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-3,4-dimethyl-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-[(1S)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 10720374 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (4S,5R)-1-[(1S)-1-(benzenesulfonyl)-5-phenylmethoxypentyl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N([C@H](CCCCOCc2ccccc2)S(=O)(=O)c2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C29H34N2O4S/c1-23-28(25-16-8-4-9-17-25)31(29(32)30(23)2)27(36(33,34)26-18-10-5-11-19-26)20-12-13-21-35-22-24-14-6-3-7-15-24/h3-11,14-19,23,27-28H,12-13,20-22H2,1-2H3/t23-,27-,28-/m0/s1 |
| InChIKey | MEMCKWQHYOLRIK-RNCAPKPVSA-N |
| XLogP | 5.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|