C12H14OS — CID 134882097
[(R)-[(1Z)-3-methylbuta-1,3-dienyl]sulfinyl]methylbenzene (PubChem CID 134882097) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is [(R)-[(1Z)-3-methylbuta-1,3-dienyl]sulfinyl]methylbenzene.
| Compound Name | [(R)-[(1Z)-3-methylbuta-1,3-dienyl]sulfinyl]methylbenzene |
|---|---|
| PubChem CID | 134882097 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [(R)-[(1Z)-3-methylbuta-1,3-dienyl]sulfinyl]methylbenzene |
| SMILES | C=C(C)/C=C\[S@](=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14OS/c1-11(2)8-9-14(13)10-12-6-4-3-5-7-12/h3-9H,1,10H2,2H3/b9-8-/t14-/m0/s1 |
| InChIKey | BJWAIIDNSGGFBR-CKXPSTMWSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|