About (E)-benzyl-chloro-ethylidene-λ4-sulfane
(E)-benzyl-chloro-ethylidene-λ4-sulfane (PubChem CID 163926559) has the molecular formula C9H11ClS
and a molecular weight of 186.71 g/mol. Its IUPAC name is (E)-benzyl-chloro-ethylidene-λ4-sulfane.
Molecular Properties
| Compound Name | (E)-benzyl-chloro-ethylidene-λ4-sulfane |
| PubChem CID | 163926559 |
| Molecular Formula | C9H11ClS |
| Molecular Weight | 186.71 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | (E)-benzyl-chloro-ethylidene-λ4-sulfane |
| SMILES | C/C=S(/Cl)Cc1ccccc1 |
| InChI | InChI=1S/C9H11ClS/c1-2-11(10)8-9-6-4-3-5-7-9/h2-7H,8H2,1H3 |
| InChIKey | REZINIDHKYCVCI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-benzyl-chloro-ethylidene-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-benzyl-chloro-ethylidene-λ4-sulfane?
The IUPAC name of (E)-benzyl-chloro-ethylidene-λ4-sulfane (CID 163926559) is (E)-benzyl-chloro-ethylidene-λ4-sulfane.
What is the SMILES notation for (E)-benzyl-chloro-ethylidene-λ4-sulfane?
The canonical SMILES for (E)-benzyl-chloro-ethylidene-λ4-sulfane is C/C=S(/Cl)Cc1ccccc1.
What is the InChIKey of (E)-benzyl-chloro-ethylidene-λ4-sulfane?
The InChIKey is REZINIDHKYCVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClS/c1-2-11(10)8-9-6-4-3-5-7-9/h2-7H,8H2,1H3.
What are the key properties of (E)-benzyl-chloro-ethylidene-λ4-sulfane?
(E)-benzyl-chloro-ethylidene-λ4-sulfane has a molecular weight of 186.71 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-benzyl-chloro-ethylidene-λ4-sulfane is sourced from PubChem (CID 163926559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).