C15H24O7 — CID 134882109
[(2R,3S,4R,5S,6S)-3-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(2-methylprop-2-enyl)oxan-4-yl] acetate (PubChem CID 134882109) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(2-methylprop-2-enyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(2-methylprop-2-enyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134882109 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3-acetyloxy-2-(hydroxymethyl)-6-methoxy-5-(2-methylprop-2-enyl)oxan-4-yl] acetate |
| SMILES | C=C(C)C[C@@H]1[C@@H](OC)O[C@H](CO)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O7/c1-8(2)6-11-13(20-9(3)17)14(21-10(4)18)12(7-16)22-15(11)19-5/h11-16H,1,6-7H2,2-5H3/t11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | TVXIXCHHRRHEIM-JARUQAPTSA-N |
| XLogP | 0.80 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|