C23H28O9S2 — CID 134882409
[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonylmethoxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate (PubChem CID 134882409) has the molecular formula C23H28O9S2 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonylmethoxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonylmethoxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134882409 |
| Molecular Formula | C23H28O9S2 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonylmethoxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)COC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H28O9S2/c1-15-5-9-17(10-6-15)33(24,25)14-28-13-19-20(21-22(29-19)31-23(3,4)30-21)32-34(26,27)18-11-7-16(2)8-12-18/h5-12,19-22H,13-14H2,1-4H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | RJSKAURAYAEKMU-CIAFKFPVSA-N |
| XLogP | 2.70 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|