C29H32O7SSe — CID 134882430
methyl (1S,5S,8R)-12-[(E)-2-(benzenesulfonyl)ethenoxy]-9,9-dimethyl-3-oxo-10-phenylselanyl-4-oxatricyclo[6.3.1.01,5]dodecane-8-carboxylate (PubChem CID 134882430) has the molecular formula C29H32O7SSe and a molecular weight of 603.60 g/mol. Its IUPAC name is methyl (1S,5S,8R)-12-[(E)-2-(benzenesulfonyl)ethenoxy]-9,9-dimethyl-3-oxo-10-phenylselanyl-4-oxatricyclo[6.3.1.01,5]dodecane-8-carboxylate.
| Compound Name | methyl (1S,5S,8R)-12-[(E)-2-(benzenesulfonyl)ethenoxy]-9,9-dimethyl-3-oxo-10-phenylselanyl-4-oxatricyclo[6.3.1.01,5]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 134882430 |
| Molecular Formula | C29H32O7SSe |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | methyl (1S,5S,8R)-12-[(E)-2-(benzenesulfonyl)ethenoxy]-9,9-dimethyl-3-oxo-10-phenylselanyl-4-oxatricyclo[6.3.1.01,5]dodecane-8-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H]3OC(=O)C[C@@]3(CC([Se]c3ccccc3)C1(C)C)C2O/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H32O7SSe/c1-27(2)23(38-21-12-8-5-9-13-21)18-28-19-24(30)36-22(28)14-15-29(27,26(31)34-3)25(28)35-16-17-37(32,33)20-10-6-4-7-11-20/h4-13,16-17,22-23,25H,14-15,18-19H2,1-3H3/b17-16+/t22-,23?,25?,28+,29+/m0/s1 |
| InChIKey | FYDZASGXDJDPLY-DBIMRHGBSA-N |
| XLogP | 3.82 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|