C23H28O7S — CID 134882429
methyl (1R,5S,8R,10R,11R)-11-(benzenesulfonylmethyl)-9,9-dimethyl-3-oxo-4,12-dioxatetracyclo[8.3.1.01,5.08,13]tetradecane-8-carboxylate (PubChem CID 134882429) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is methyl (1R,5S,8R,10R,11R)-11-(benzenesulfonylmethyl)-9,9-dimethyl-3-oxo-4,12-dioxatetracyclo[8.3.1.01,5.08,13]tetradecane-8-carboxylate.
| Compound Name | methyl (1R,5S,8R,10R,11R)-11-(benzenesulfonylmethyl)-9,9-dimethyl-3-oxo-4,12-dioxatetracyclo[8.3.1.01,5.08,13]tetradecane-8-carboxylate |
|---|---|
| PubChem CID | 134882429 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | methyl (1R,5S,8R,10R,11R)-11-(benzenesulfonylmethyl)-9,9-dimethyl-3-oxo-4,12-dioxatetracyclo[8.3.1.01,5.08,13]tetradecane-8-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@H]3OC(=O)C[C@]34C[C@@H]([C@H](CS(=O)(=O)c3ccccc3)OC41)C2(C)C |
| InChI | InChI=1S/C23H28O7S/c1-21(2)15-11-22-12-18(24)30-17(22)9-10-23(21,20(25)28-3)19(22)29-16(15)13-31(26,27)14-7-5-4-6-8-14/h4-8,15-17,19H,9-13H2,1-3H3/t15-,16-,17-,19?,22+,23+/m0/s1 |
| InChIKey | CVPIVHGWSFKXEP-ACHZANQJSA-N |
| XLogP | 2.53 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |