C21H20O6S — CID 10763510
methyl (1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-13-carboxylate (PubChem CID 10763510) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is methyl (1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-13-carboxylate.
| Compound Name | methyl (1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-13-carboxylate |
|---|---|
| PubChem CID | 10763510 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | methyl (1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-diene-13-carboxylate |
| SMILES | COC(=O)C12C3(S(=O)(=O)c4ccccc4)[C@@H]4C=C[C@@]1(CCC[C@]21C=C[C@H]3O1)O4 |
| InChI | InChI=1S/C21H20O6S/c1-25-17(22)21-18-10-5-11-19(21)13-9-16(27-19)20(21,15(26-18)8-12-18)28(23,24)14-6-3-2-4-7-14/h2-4,6-9,12-13,15-16H,5,10-11H2,1H3/t15-,16+,18+,19-,20?,21? |
| InChIKey | WQATXZNALGYNID-ISRJBHOESA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|