C21H30O2 — CID 134882748
1-[(2R,4aR,5R,8S,8aS)-4a,8-dimethyl-5-phenylmethoxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]ethanone (PubChem CID 134882748) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-[(2R,4aR,5R,8S,8aS)-4a,8-dimethyl-5-phenylmethoxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]ethanone.
| Compound Name | 1-[(2R,4aR,5R,8S,8aS)-4a,8-dimethyl-5-phenylmethoxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 134882748 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-[(2R,4aR,5R,8S,8aS)-4a,8-dimethyl-5-phenylmethoxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@@]2(C)[C@H](OCc3ccccc3)CC[C@H](C)[C@@H]2C1 |
| InChI | InChI=1S/C21H30O2/c1-15-9-10-20(23-14-17-7-5-4-6-8-17)21(3)12-11-18(16(2)22)13-19(15)21/h4-8,15,18-20H,9-14H2,1-3H3/t15-,18+,19-,20+,21+/m0/s1 |
| InChIKey | NNGWBYRGUBJCIK-FZHKGVQDSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |