C12H18O4 — CID 134883065
(1S,2S,6R,7R,11Z)-11-ethylidene-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecane (PubChem CID 134883065) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1S,2S,6R,7R,11Z)-11-ethylidene-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecane.
| Compound Name | (1S,2S,6R,7R,11Z)-11-ethylidene-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecane |
|---|---|
| PubChem CID | 134883065 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1S,2S,6R,7R,11Z)-11-ethylidene-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecane |
| SMILES | C/C=C1/COC[C@H]2O[C@@H]1[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18O4/c1-4-7-5-13-6-8-10-11(9(7)14-8)16-12(2,3)15-10/h4,8-11H,5-6H2,1-3H3/b7-4-/t8-,9+,10-,11+/m1/s1 |
| InChIKey | OZRAVNXLCUYTQR-CDEVXYHISA-N |
| XLogP | 1.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|