C26H31NO8 — CID 134883723
(2S,3R,4S,5R)-4-[[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 134883723) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4-[[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (2S,3R,4S,5R)-4-[[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 134883723 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (2S,3R,4S,5R)-4-[[(2S,3R,4S,5R)-3-hydroxy-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]amino]-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@@H]1[C@H](N[C@@H]2[C@@H]3OCC(O3)[C@@H](OCc3ccccc3)[C@@H]2O)[C@@H]2OCC(O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO8/c28-21-19(25-32-13-17(34-25)23(21)30-11-15-7-3-1-4-8-15)27-20-22(29)24(18-14-33-26(20)35-18)31-12-16-9-5-2-6-10-16/h1-10,17-29H,11-14H2/t17?,18?,19-,20-,21+,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | HSKSBUNDJYNWEJ-LMYBWDTPSA-N |
| XLogP | 0.72 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |