C13H17NO4S — CID 134883968
methyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 134883968) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | methyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134883968 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | CCC1C(C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO4S/c1-4-11-12(13(15)18-3)14(11)19(16,17)10-7-5-9(2)6-8-10/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | CEFMJONMBLERCO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|