C16H23NO4S — CID 134883969
tert-butyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 134883969) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | tert-butyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134883969 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | tert-butyl 3-ethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | CCC1C(C(=O)OC(C)(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO4S/c1-6-13-14(15(18)21-16(3,4)5)17(13)22(19,20)12-9-7-11(2)8-10-12/h7-10,13-14H,6H2,1-5H3 |
| InChIKey | RZIKPWKNVOWOOY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|