C27H31NO6 — CID 134884114
N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(1,3-diphenylprop-2-ynyl)hydroxylamine (PubChem CID 134884114) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(1,3-diphenylprop-2-ynyl)hydroxylamine.
| Compound Name | N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(1,3-diphenylprop-2-ynyl)hydroxylamine |
|---|---|
| PubChem CID | 134884114 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(1,3-diphenylprop-2-ynyl)hydroxylamine |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)OC(N(O)C(C#Cc3ccccc3)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C27H31NO6/c1-26(2)30-17-21(32-26)22-23-24(34-27(3,4)33-23)25(31-22)28(29)20(19-13-9-6-10-14-19)16-15-18-11-7-5-8-12-18/h5-14,20-25,29H,17H2,1-4H3/t20?,21-,22-,23+,24+,25?/m1/s1 |
| InChIKey | YCBDGHLAFFMCLD-ZOHXDLJVSA-N |
| XLogP | 3.87 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|