C9H23NO — CID 134884436
3,3-dimethylbutan-2-yl(trimethyl)azanium hydroxide (PubChem CID 134884436) has the molecular formula C9H23NO and a molecular weight of 161.29 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl(trimethyl)azanium hydroxide.
| Compound Name | 3,3-dimethylbutan-2-yl(trimethyl)azanium hydroxide |
|---|---|
| PubChem CID | 134884436 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | 3,3-dimethylbutan-2-yl(trimethyl)azanium hydroxide |
| SMILES | CC(C(C)(C)C)[N+](C)(C)C.[OH-] |
| InChI | InChI=1S/C9H22N.H2O/c1-8(9(2,3)4)10(5,6)7;/h8H,1-7H3;1H2/q+1;/p-1 |
| InChIKey | HRLKEXHLHWVZJR-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|