C13H18CrO2 — CID 134884592
[[2-(cyclopenten-1-yl)-4-methoxy-4-methylcyclobuten-1-yl]-methoxymethylidene]chromium (PubChem CID 134884592) has the molecular formula C13H18CrO2 and a molecular weight of 258.28 g/mol. Its IUPAC name is [[2-(cyclopenten-1-yl)-4-methoxy-4-methylcyclobuten-1-yl]-methoxymethylidene]chromium.
| Compound Name | [[2-(cyclopenten-1-yl)-4-methoxy-4-methylcyclobuten-1-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 134884592 |
| Molecular Formula | C13H18CrO2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [[2-(cyclopenten-1-yl)-4-methoxy-4-methylcyclobuten-1-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCC2)CC1(C)OC |
| InChI | InChI=1S/C13H18O2.Cr/c1-13(15-3)8-11(12(13)9-14-2)10-6-4-5-7-10;/h6H,4-5,7-8H2,1-3H3; |
| InChIKey | UOQMCVUXBDEDSX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |