C13H20O2 — CID 134884787
2,3,5,8-tetramethylnona-3,4-dien-6-yne-2,8-diol (PubChem CID 134884787) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3,5,8-tetramethylnona-3,4-dien-6-yne-2,8-diol.
| Compound Name | 2,3,5,8-tetramethylnona-3,4-dien-6-yne-2,8-diol |
|---|---|
| PubChem CID | 134884787 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2,3,5,8-tetramethylnona-3,4-dien-6-yne-2,8-diol |
| SMILES | CC(=C=C(C)C(C)(C)O)C#CC(C)(C)O |
| InChI | InChI=1S/C13H20O2/c1-10(7-8-12(3,4)14)9-11(2)13(5,6)15/h14-15H,1-6H3 |
| InChIKey | SIDIAKPOQCROPQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|