C19H18CrO8 — CID 134884872
carbon monoxide;[[7-(cyclopenten-1-yl)-3,3-dimethyl-2,4-dioxabicyclo[3.2.0]hept-6-en-6-yl]-methoxymethylidene]chromium (PubChem CID 134884872) has the molecular formula C19H18CrO8 and a molecular weight of 426.34 g/mol. Its IUPAC name is carbon monoxide;[[7-(cyclopenten-1-yl)-3,3-dimethyl-2,4-dioxabicyclo[3.2.0]hept-6-en-6-yl]-methoxymethylidene]chromium.
| Compound Name | carbon monoxide;[[7-(cyclopenten-1-yl)-3,3-dimethyl-2,4-dioxabicyclo[3.2.0]hept-6-en-6-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 134884872 |
| Molecular Formula | C19H18CrO8 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | carbon monoxide;[[7-(cyclopenten-1-yl)-3,3-dimethyl-2,4-dioxabicyclo[3.2.0]hept-6-en-6-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCC2)C2OC(C)(C)OC12.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C14H18O3.5CO.Cr/c1-14(2)16-12-10(8-15-3)11(13(12)17-14)9-6-4-5-7-9;5*1-2;/h6,12-13H,4-5,7H2,1-3H3;;;;;; |
| InChIKey | XWOZVPSZVLBFFW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 127.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|