C21H30O8 — CID 71661424
[(2S)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate (PubChem CID 71661424) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is [(2S)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate.
| Compound Name | [(2S)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 71661424 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(2S)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] methyl carbonate |
| SMILES | C=CCOC(=O)OC(=C)/C(C)=C/[C@@H]1OC(C)(C)O[C@H]1C[C@H](OC(=O)OC)C(=C)C |
| InChI | InChI=1S/C21H30O8/c1-9-10-25-20(23)26-15(5)14(4)11-17-18(29-21(6,7)28-17)12-16(13(2)3)27-19(22)24-8/h9,11,16-18H,1-2,5,10,12H2,3-4,6-8H3/b14-11+/t16-,17-,18-/m0/s1 |
| InChIKey | ITZOAVGOMFWXBV-FCZFYOHZSA-N |
| XLogP | 4.42 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|