C13H21NO5 — CID 22955154
prop-2-enyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxobutyl]carbamate (PubChem CID 22955154) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is prop-2-enyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxobutyl]carbamate.
| Compound Name | prop-2-enyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxobutyl]carbamate |
|---|---|
| PubChem CID | 22955154 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | prop-2-enyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-oxobutyl]carbamate |
| SMILES | C=CCOC(=O)NC(CC(C)=O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C13H21NO5/c1-5-6-17-12(16)14-10(7-9(2)15)11-8-18-13(3,4)19-11/h5,10-11H,1,6-8H2,2-4H3,(H,14,16) |
| InChIKey | BRBJHKSANTZKAU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|