C26H31NO9 — CID 71663440
[(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] 4-nitrobenzoate (PubChem CID 71663440) has the molecular formula C26H31NO9 and a molecular weight of 501.53 g/mol. Its IUPAC name is [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 71663440 |
| Molecular Formula | C26H31NO9 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[(1E)-2-methyl-3-prop-2-enoxycarbonyloxybuta-1,3-dienyl]-1,3-dioxolan-4-yl]-3-methylbut-3-en-2-yl] 4-nitrobenzoate |
| SMILES | C=CCOC(=O)OC(=C)/C(C)=C/[C@@H]1OC(C)(C)O[C@H]1C[C@@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C(=C)C |
| InChI | InChI=1S/C26H31NO9/c1-8-13-32-25(29)33-18(5)17(4)14-22-23(36-26(6,7)35-22)15-21(16(2)3)34-24(28)19-9-11-20(12-10-19)27(30)31/h8-12,14,21-23H,1-2,5,13,15H2,3-4,6-7H3/b17-14+/t21-,22+,23+/m1/s1 |
| InChIKey | GKTBHLFLXXVEDP-FIOXGUSQSA-N |
| XLogP | 5.41 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|