About but-3-enoyl 4-nitrobenzoate
but-3-enoyl 4-nitrobenzoate (PubChem CID 174533485) has the molecular formula C11H9NO5
and a molecular weight of 235.19 g/mol. Its IUPAC name is but-3-enoyl 4-nitrobenzoate.
Molecular Properties
| Compound Name | but-3-enoyl 4-nitrobenzoate |
| PubChem CID | 174533485 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | but-3-enoyl 4-nitrobenzoate |
| SMILES | C=CCC(=O)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9NO5/c1-2-3-10(13)17-11(14)8-4-6-9(7-5-8)12(15)16/h2,4-7H,1,3H2 |
| InChIKey | WQMLHCRZKHDYAM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-enoyl 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enoyl 4-nitrobenzoate?
The IUPAC name of but-3-enoyl 4-nitrobenzoate (CID 174533485) is but-3-enoyl 4-nitrobenzoate.
What is the SMILES notation for but-3-enoyl 4-nitrobenzoate?
The canonical SMILES for but-3-enoyl 4-nitrobenzoate is C=CCC(=O)OC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of but-3-enoyl 4-nitrobenzoate?
The InChIKey is WQMLHCRZKHDYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO5/c1-2-3-10(13)17-11(14)8-4-6-9(7-5-8)12(15)16/h2,4-7H,1,3H2.
What are the key properties of but-3-enoyl 4-nitrobenzoate?
but-3-enoyl 4-nitrobenzoate has a molecular weight of 235.19 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enoyl 4-nitrobenzoate is sourced from PubChem (CID 174533485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).