C17H23NO2 — CID 11065624
1-nitro-4-[(4Z)-5-propylocta-4,7-dien-4-yl]benzene (PubChem CID 11065624) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-nitro-4-[(4Z)-5-propylocta-4,7-dien-4-yl]benzene.
| Compound Name | 1-nitro-4-[(4Z)-5-propylocta-4,7-dien-4-yl]benzene |
|---|---|
| PubChem CID | 11065624 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-nitro-4-[(4Z)-5-propylocta-4,7-dien-4-yl]benzene |
| SMILES | C=CC/C(CCC)=C(/CCC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H23NO2/c1-4-7-14(8-5-2)17(9-6-3)15-10-12-16(13-11-15)18(19)20/h4,10-13H,1,5-9H2,2-3H3/b17-14+ |
| InChIKey | DVVIWFPLAUJOOD-SAPNQHFASA-N |
| XLogP | 5.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|