C24H34O7SSi — CID 134885268
[(1R,3S,7R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyn-7-yl] methanesulfonate (PubChem CID 134885268) has the molecular formula C24H34O7SSi and a molecular weight of 494.68 g/mol. Its IUPAC name is [(1R,3S,7R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyn-7-yl] methanesulfonate.
| Compound Name | [(1R,3S,7R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyn-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 134885268 |
| Molecular Formula | C24H34O7SSi |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [(1R,3S,7R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxatricyclo[8.3.0.01,3]tridec-10-en-4,8-diyn-7-yl] methanesulfonate |
| SMILES | CC1(C)OCC([C@]2(OS(C)(=O)=O)C#CC3=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]34O[C@H]4C#CC2)O1 |
| InChI | InChI=1S/C24H34O7SSi/c1-21(2,3)33(7,8)30-18-14-17-11-13-23(31-32(6,25)26,20-16-27-22(4,5)28-20)12-9-10-19-24(17,15-18)29-19/h14,18-20H,12,15-16H2,1-8H3/t18-,19+,20?,23-,24-/m1/s1 |
| InChIKey | ZVSUXPGNUMOTTG-AMQSJEMQSA-N |
| XLogP | 3.12 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|