C23H30O4Si — CID 101029128
tert-butyl-[[(1R,3S,6E,12S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]trideca-6,10-dien-4,8-diyn-12-yl]oxy]-dimethylsilane (PubChem CID 101029128) has the molecular formula C23H30O4Si and a molecular weight of 398.58 g/mol. Its IUPAC name is tert-butyl-[[(1R,3S,6E,12S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]trideca-6,10-dien-4,8-diyn-12-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3S,6E,12S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]trideca-6,10-dien-4,8-diyn-12-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101029128 |
| Molecular Formula | C23H30O4Si |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | tert-butyl-[[(1R,3S,6E,12S)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxatricyclo[8.3.0.01,3]trideca-6,10-dien-4,8-diyn-12-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)OC[C@H](/C2=C/C#C[C@@H]3O[C@@]34C[C@H](O[Si](C)(C)C(C)(C)C)C=C4C#C2)O1 |
| InChI | InChI=1S/C23H30O4Si/c1-21(2,3)28(6,7)27-18-13-17-12-11-16(19-15-24-22(4,5)25-19)9-8-10-20-23(17,14-18)26-20/h9,13,18-20H,14-15H2,1-7H3/b16-9+/t18-,19-,20+,23-/m1/s1 |
| InChIKey | ZGIJKPBJYRAOGL-SOWQLQGNSA-N |
| XLogP | 3.94 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|