C17H28O3Si — CID 134833055
[(3aR,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-3a-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134833055) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is [(3aR,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-3a-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-3a-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134833055 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(3aR,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-3a-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C#CC1=CC[C@H]2OC(C)(C)O[C@@]12CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-9-13-10-11-14-17(13,20-16(5,6)19-14)12-18-21(7,8)15(2,3)4/h1,10,14H,11-12H2,2-8H3/t14-,17+/m1/s1 |
| InChIKey | ADOQVUPTRPGZAZ-PBHICJAKSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|