C13H20O2Si — CID 71623383
[(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane (PubChem CID 71623383) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane.
| Compound Name | [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 71623383 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [(3aS,6S,6aS)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-trimethylsilane |
| SMILES | C#CC1=C[C@H]([Si](C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H20O2Si/c1-7-9-8-10(16(4,5)6)12-11(9)14-13(2,3)15-12/h1,8,10-12H,2-6H3/t10-,11-,12+/m0/s1 |
| InChIKey | XOXKUMYIIKQEAK-SDDRHHMPSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|