C10H18BrNO — CID 134886274
(1S,2S,5R)-1-bromo-5-methyl-1-nitroso-2-propan-2-ylcyclohexane (PubChem CID 134886274) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is (1S,2S,5R)-1-bromo-5-methyl-1-nitroso-2-propan-2-ylcyclohexane.
| Compound Name | (1S,2S,5R)-1-bromo-5-methyl-1-nitroso-2-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 134886274 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (1S,2S,5R)-1-bromo-5-methyl-1-nitroso-2-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]1(Br)N=O |
| InChI | InChI=1S/C10H18BrNO/c1-7(2)9-5-4-8(3)6-10(9,11)12-13/h7-9H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | BCIRGGWTJCMDPF-KXUCPTDWSA-N |
| XLogP | 3.94 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|