C18H36OSi — CID 134887188
(2E,7E)-6-methyl-6-trimethylsilyltetradeca-2,7-dien-5-ol (PubChem CID 134887188) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is (2E,7E)-6-methyl-6-trimethylsilyltetradeca-2,7-dien-5-ol.
| Compound Name | (2E,7E)-6-methyl-6-trimethylsilyltetradeca-2,7-dien-5-ol |
|---|---|
| PubChem CID | 134887188 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2E,7E)-6-methyl-6-trimethylsilyltetradeca-2,7-dien-5-ol |
| SMILES | C/C=C/CC(O)C(C)(/C=C/CCCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-7-9-11-12-13-14-16-18(3,20(4,5)6)17(19)15-10-8-2/h8,10,14,16-17,19H,7,9,11-13,15H2,1-6H3/b10-8+,16-14+ |
| InChIKey | OYSOTYLJVOTTQX-QBTNJIBQSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|