C18H27Cl3 — CID 134887836
1,3,5-tris(4-chlorobutyl)benzene (PubChem CID 134887836) has the molecular formula C18H27Cl3 and a molecular weight of 349.77 g/mol. Its IUPAC name is 1,3,5-tris(4-chlorobutyl)benzene.
| Compound Name | 1,3,5-tris(4-chlorobutyl)benzene |
|---|---|
| PubChem CID | 134887836 |
| Molecular Formula | C18H27Cl3 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1,3,5-tris(4-chlorobutyl)benzene |
| SMILES | ClCCCCc1cc(CCCCCl)cc(CCCCCl)c1 |
| InChI | InChI=1S/C18H27Cl3/c19-10-4-1-7-16-13-17(8-2-5-11-20)15-18(14-16)9-3-6-12-21/h13-15H,1-12H2 |
| InChIKey | ULVROHUZQKWALU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|