C19H28O2 — CID 134887928
(2Z,7E)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,7-dien-4-yne-1,6-diol (PubChem CID 134887928) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2Z,7E)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,7-dien-4-yne-1,6-diol.
| Compound Name | (2Z,7E)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,7-dien-4-yne-1,6-diol |
|---|---|
| PubChem CID | 134887928 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2Z,7E)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,7-dien-4-yne-1,6-diol |
| SMILES | C/C(C#CC(O)/C(C)=C/CC1=CCCCC1(C)C)=C/CO |
| InChI | InChI=1S/C19H28O2/c1-15(12-14-20)8-11-18(21)16(2)9-10-17-7-5-6-13-19(17,3)4/h7,9,12,18,20-21H,5-6,10,13-14H2,1-4H3/b15-12-,16-9+ |
| InChIKey | YPCQNOREBJZHRB-VHLLIACMSA-N |
| XLogP | 3.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|