About (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol
(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol (PubChem CID 6504386) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol |
| PubChem CID | 6504386 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol |
| SMILES | CC1=C(/C=C(\C)C(C)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H24O/c1-10-7-6-8-14(4,5)13(10)9-11(2)12(3)15/h9,12,15H,6-8H2,1-5H3/b11-9+ |
| InChIKey | RGCSRKQFSSXYRE-PKNBQFBNSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol?
The IUPAC name of (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol (CID 6504386) is (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol.
What is the SMILES notation for (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol?
The canonical SMILES for (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol is CC1=C(/C=C(\C)C(C)O)C(C)(C)CCC1.
What is the InChIKey of (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol?
The InChIKey is RGCSRKQFSSXYRE-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H24O/c1-10-7-6-8-14(4,5)13(10)9-11(2)12(3)15/h9,12,15H,6-8H2,1-5H3/b11-9+.
What are the key properties of (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol?
(E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol has a molecular weight of 208.34 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ol is sourced from PubChem (CID 6504386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).