About (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate
(3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate (PubChem CID 134888041) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate.
Analyze (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate?
The IUPAC name of (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate (CID 134888041) is (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate.
What is the SMILES notation for (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate?
The canonical SMILES for (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate is CC(=O)OC1=CC(C2C=CC=C2)C=CC=C1.
What is the InChIKey of (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate?
The InChIKey is YPZSFFWPERWJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-11(15)16-14-9-5-4-8-13(10-14)12-6-2-3-7-12/h2-10,12-13H,1H3.
What are the key properties of (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate?
(3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate has a molecular weight of 214.26 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopenta-2,4-dien-1-ylcyclohepta-1,4,6-trien-1-yl) acetate is sourced from PubChem (CID 134888041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).