About carbon monoxide;trimethyl phosphite;tungsten
carbon monoxide;trimethyl phosphite;tungsten (PubChem CID 134889037) has the molecular formula C8H9O8PW
and a molecular weight of 447.97 g/mol. Its IUPAC name is carbon monoxide;trimethyl phosphite;tungsten.
Molecular Properties
| Compound Name | carbon monoxide;trimethyl phosphite;tungsten |
| PubChem CID | 134889037 |
| Molecular Formula | C8H9O8PW |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | carbon monoxide;trimethyl phosphite;tungsten |
| SMILES | COP(OC)OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C3H9O3P.5CO.W/c1-4-7(5-2)6-3;5*1-2;/h1-3H3;;;;;; |
| InChIKey | WDXPUQDZMINJAS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 127.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;trimethyl phosphite;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;trimethyl phosphite;tungsten?
The IUPAC name of carbon monoxide;trimethyl phosphite;tungsten (CID 134889037) is carbon monoxide;trimethyl phosphite;tungsten.
What is the SMILES notation for carbon monoxide;trimethyl phosphite;tungsten?
The canonical SMILES for carbon monoxide;trimethyl phosphite;tungsten is COP(OC)OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;trimethyl phosphite;tungsten?
The InChIKey is WDXPUQDZMINJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O3P.5CO.W/c1-4-7(5-2)6-3;5*1-2;/h1-3H3;;;;;;.
What are the key properties of carbon monoxide;trimethyl phosphite;tungsten?
carbon monoxide;trimethyl phosphite;tungsten has a molecular weight of 447.97 g/mol, XLogP of 0.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;trimethyl phosphite;tungsten is sourced from PubChem (CID 134889037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).