About carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene
carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene (PubChem CID 134889146) has the molecular formula C13H13CrIO3
and a molecular weight of 396.14 g/mol. Its IUPAC name is carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene.
Molecular Properties
| Compound Name | carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene |
| PubChem CID | 134889146 |
| Molecular Formula | C13H13CrIO3 |
| Molecular Weight | 396.14 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene |
| SMILES | C[C@H](c1ccccc1)[C@@H](C)I.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C10H13I.3CO.Cr/c1-8(9(2)11)10-6-4-3-5-7-10;3*1-2;/h3-9H,1-2H3;;;;/t8-,9+;;;;/m0..../s1 |
| InChIKey | WUCWYISRESQJOS-XJGUQWRXSA-N |
| XLogP | 3.50 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene?
The IUPAC name of carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene (CID 134889146) is carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene.
What is the SMILES notation for carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene?
The canonical SMILES for carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene is C[C@H](c1ccccc1)[C@@H](C)I.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene?
The InChIKey is WUCWYISRESQJOS-XJGUQWRXSA-N. The full InChI is InChI=1S/C10H13I.3CO.Cr/c1-8(9(2)11)10-6-4-3-5-7-10;3*1-2;/h3-9H,1-2H3;;;;/t8-,9+;;;;/m0..../s1.
What are the key properties of carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene?
carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene has a molecular weight of 396.14 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;[(2R,3R)-3-iodobutan-2-yl]benzene is sourced from PubChem (CID 134889146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).